C16H18ClNO4 — CID 68508263
2-O-tert-butyl 1-O-ethyl 5-chloroindole-1,2-dicarboxylate (PubChem CID 68508263) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-ethyl 5-chloroindole-1,2-dicarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-ethyl 5-chloroindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 68508263 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-O-tert-butyl 1-O-ethyl 5-chloroindole-1,2-dicarboxylate |
| SMILES | CCOC(=O)n1c(C(=O)OC(C)(C)C)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H18ClNO4/c1-5-21-15(20)18-12-7-6-11(17)8-10(12)9-13(18)14(19)22-16(2,3)4/h6-9H,5H2,1-4H3 |
| InChIKey | PNCRHGNODZFIEZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |