C16H18ClNO3 — CID 91475479
tert-butyl 3-(5-chloro-1-methylindol-2-yl)-3-oxopropanoate (PubChem CID 91475479) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is tert-butyl 3-(5-chloro-1-methylindol-2-yl)-3-oxopropanoate.
| Compound Name | tert-butyl 3-(5-chloro-1-methylindol-2-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 91475479 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | tert-butyl 3-(5-chloro-1-methylindol-2-yl)-3-oxopropanoate |
| SMILES | Cn1c(C(=O)CC(=O)OC(C)(C)C)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H18ClNO3/c1-16(2,3)21-15(20)9-14(19)13-8-10-7-11(17)5-6-12(10)18(13)4/h5-8H,9H2,1-4H3 |
| InChIKey | LNSKGMGZEYCCLN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|