C11H16N2O4 — CID 144913835
tert-butyl 2-(2-hydroxyethyl)-6-oxopyrimidine-1-carboxylate (PubChem CID 144913835) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is tert-butyl 2-(2-hydroxyethyl)-6-oxopyrimidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-hydroxyethyl)-6-oxopyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 144913835 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | tert-butyl 2-(2-hydroxyethyl)-6-oxopyrimidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(CCO)nccc1=O |
| InChI | InChI=1S/C11H16N2O4/c1-11(2,3)17-10(16)13-8(5-7-14)12-6-4-9(13)15/h4,6,14H,5,7H2,1-3H3 |
| InChIKey | QFJWYYMIDWWPQL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |