C24H33N3O3 — CID 67029992
tert-butyl 4-[6-[2-[4-(2-hydroxyethyl)phenyl]ethyl]-3-pyridinyl]piperazine-1-carboxylate (PubChem CID 67029992) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is tert-butyl 4-[6-[2-[4-(2-hydroxyethyl)phenyl]ethyl]-3-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[2-[4-(2-hydroxyethyl)phenyl]ethyl]-3-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67029992 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | tert-butyl 4-[6-[2-[4-(2-hydroxyethyl)phenyl]ethyl]-3-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(CCc3ccc(CCO)cc3)nc2)CC1 |
| InChI | InChI=1S/C24H33N3O3/c1-24(2,3)30-23(29)27-15-13-26(14-16-27)22-11-10-21(25-18-22)9-8-19-4-6-20(7-5-19)12-17-28/h4-7,10-11,18,28H,8-9,12-17H2,1-3H3 |
| InChIKey | DVEDJWQDALZYJA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |