C22H28N4O3 — CID 58181358
[4-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]phenyl]methyl 2-aminoacetate (PubChem CID 58181358) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is [4-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]phenyl]methyl 2-aminoacetate.
| Compound Name | [4-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]phenyl]methyl 2-aminoacetate |
|---|---|
| PubChem CID | 58181358 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | [4-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]phenyl]methyl 2-aminoacetate |
| SMILES | CC(=O)N1CCN(c2ccc(CCc3ccc(COC(=O)CN)cc3)nc2)CC1 |
| InChI | InChI=1S/C22H28N4O3/c1-17(27)25-10-12-26(13-11-25)21-9-8-20(24-15-21)7-6-18-2-4-19(5-3-18)16-29-22(28)14-23/h2-5,8-9,15H,6-7,10-14,16,23H2,1H3 |
| InChIKey | NMMGFMJGKOJKIO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |