C23H33N5O4S — CID 174614422
5-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]thiophene-2-carbohydrazide;tert-butyl formate (PubChem CID 174614422) has the molecular formula C23H33N5O4S and a molecular weight of 475.62 g/mol. Its IUPAC name is 5-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]thiophene-2-carbohydrazide;tert-butyl formate.
| Compound Name | 5-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]thiophene-2-carbohydrazide;tert-butyl formate |
|---|---|
| PubChem CID | 174614422 |
| Molecular Formula | C23H33N5O4S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 5-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]thiophene-2-carbohydrazide;tert-butyl formate |
| SMILES | CC(=O)N1CCN(c2ccc(CCc3ccc(C(=O)NN)s3)nc2)CC1.CC(C)(C)OC=O |
| InChI | InChI=1S/C18H23N5O2S.C5H10O2/c1-13(24)22-8-10-23(11-9-22)15-4-2-14(20-12-15)3-5-16-6-7-17(26-16)18(25)21-19;1-5(2,3)7-4-6/h2,4,6-7,12H,3,5,8-11,19H2,1H3,(H,21,25);4H,1-3H3 |
| InChIKey | LKPHQCFIJZIQDN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|