C19H27N5OS — CID 174614522
1-[4-[6-[2-[5-[amino(ethyl)amino]thiophen-2-yl]ethyl]-3-pyridinyl]piperazin-1-yl]ethanone (PubChem CID 174614522) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is 1-[4-[6-[2-[5-[amino(ethyl)amino]thiophen-2-yl]ethyl]-3-pyridinyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[6-[2-[5-[amino(ethyl)amino]thiophen-2-yl]ethyl]-3-pyridinyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 174614522 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-[4-[6-[2-[5-[amino(ethyl)amino]thiophen-2-yl]ethyl]-3-pyridinyl]piperazin-1-yl]ethanone |
| SMILES | CCN(N)c1ccc(CCc2ccc(N3CCN(C(C)=O)CC3)cn2)s1 |
| InChI | InChI=1S/C19H27N5OS/c1-3-24(20)19-9-8-18(26-19)7-5-16-4-6-17(14-21-16)23-12-10-22(11-13-23)15(2)25/h4,6,8-9,14H,3,5,7,10-13,20H2,1-2H3 |
| InChIKey | JPRZTLVMPCNUFA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|