C20H25N3O3S — CID 91363189
[5-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]thiophen-2-yl] propanoate (PubChem CID 91363189) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is [5-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]thiophen-2-yl] propanoate.
| Compound Name | [5-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]thiophen-2-yl] propanoate |
|---|---|
| PubChem CID | 91363189 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | [5-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]thiophen-2-yl] propanoate |
| SMILES | CCC(=O)Oc1ccc(CCc2ccc(N3CCN(C(C)=O)CC3)cn2)s1 |
| InChI | InChI=1S/C20H25N3O3S/c1-3-19(25)26-20-9-8-18(27-20)7-5-16-4-6-17(14-21-16)23-12-10-22(11-13-23)15(2)24/h4,6,8-9,14H,3,5,7,10-13H2,1-2H3 |
| InChIKey | MSDKCPIEXXZZDW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |