C19H27N5O4 — CID 109187379
ethyl 4-[5-(4-acetylpiperazin-1-yl)pyridine-2-carbonyl]piperazine-1-carboxylate (PubChem CID 109187379) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is ethyl 4-[5-(4-acetylpiperazin-1-yl)pyridine-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[5-(4-acetylpiperazin-1-yl)pyridine-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109187379 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | ethyl 4-[5-(4-acetylpiperazin-1-yl)pyridine-2-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(N3CCN(C(C)=O)CC3)cn2)CC1 |
| InChI | InChI=1S/C19H27N5O4/c1-3-28-19(27)24-12-10-23(11-13-24)18(26)17-5-4-16(14-20-17)22-8-6-21(7-9-22)15(2)25/h4-5,14H,3,6-13H2,1-2H3 |
| InChIKey | MWZBRAOZLUOXBH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 86.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |