C15H22N4O3 — CID 109183834
5-(4-acetylpiperazin-1-yl)-N-(2-methoxyethyl)pyridine-2-carboxamide (PubChem CID 109183834) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 5-(4-acetylpiperazin-1-yl)-N-(2-methoxyethyl)pyridine-2-carboxamide.
| Compound Name | 5-(4-acetylpiperazin-1-yl)-N-(2-methoxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109183834 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 5-(4-acetylpiperazin-1-yl)-N-(2-methoxyethyl)pyridine-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc(N2CCN(C(C)=O)CC2)cn1 |
| InChI | InChI=1S/C15H22N4O3/c1-12(20)18-6-8-19(9-7-18)13-3-4-14(17-11-13)15(21)16-5-10-22-2/h3-4,11H,5-10H2,1-2H3,(H,16,21) |
| InChIKey | WJNIRSGWHZMUGC-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|