C21H26N4O4 — CID 109209181
4-(4-acetylpiperazin-1-yl)-N-[2-(4-methoxyphenoxy)ethyl]pyridine-2-carboxamide (PubChem CID 109209181) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N-[2-(4-methoxyphenoxy)ethyl]pyridine-2-carboxamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N-[2-(4-methoxyphenoxy)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109209181 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N-[2-(4-methoxyphenoxy)ethyl]pyridine-2-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)c2cc(N3CCN(C(C)=O)CC3)ccn2)cc1 |
| InChI | InChI=1S/C21H26N4O4/c1-16(26)24-10-12-25(13-11-24)17-7-8-22-20(15-17)21(27)23-9-14-29-19-5-3-18(28-2)4-6-19/h3-8,15H,9-14H2,1-2H3,(H,23,27) |
| InChIKey | CHOAPJZFQFXJAX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|