C14H21N5O3 — CID 109113907
6-(4-acetylpiperazin-1-yl)-N-(2-methoxyethyl)pyridazine-3-carboxamide (PubChem CID 109113907) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 6-(4-acetylpiperazin-1-yl)-N-(2-methoxyethyl)pyridazine-3-carboxamide.
| Compound Name | 6-(4-acetylpiperazin-1-yl)-N-(2-methoxyethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109113907 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 6-(4-acetylpiperazin-1-yl)-N-(2-methoxyethyl)pyridazine-3-carboxamide |
| SMILES | COCCNC(=O)c1ccc(N2CCN(C(C)=O)CC2)nn1 |
| InChI | InChI=1S/C14H21N5O3/c1-11(20)18-6-8-19(9-7-18)13-4-3-12(16-17-13)14(21)15-5-10-22-2/h3-4H,5-10H2,1-2H3,(H,15,21) |
| InChIKey | XTZBVEIVTIFHTA-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|