C20H27N5O3S — CID 67267295
2-[5-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]thiophen-2-yl]ethyl N-aminocarbamate (PubChem CID 67267295) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is 2-[5-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]thiophen-2-yl]ethyl N-aminocarbamate.
| Compound Name | 2-[5-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]thiophen-2-yl]ethyl N-aminocarbamate |
|---|---|
| PubChem CID | 67267295 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[5-[2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethyl]thiophen-2-yl]ethyl N-aminocarbamate |
| SMILES | CC(=O)N1CCN(c2ccc(CCc3ccc(CCOC(=O)NN)s3)nc2)CC1 |
| InChI | InChI=1S/C20H27N5O3S/c1-15(26)24-9-11-25(12-10-24)17-4-2-16(22-14-17)3-5-18-6-7-19(29-18)8-13-28-20(27)23-21/h2,4,6-7,14H,3,5,8-13,21H2,1H3,(H,23,27) |
| InChIKey | MJABPEKUWKADQZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|