C21H25N3O3S — CID 58181289
2-[5-[(E)-2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethenyl]thiophen-2-yl]ethyl acetate (PubChem CID 58181289) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 2-[5-[(E)-2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethenyl]thiophen-2-yl]ethyl acetate.
| Compound Name | 2-[5-[(E)-2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethenyl]thiophen-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 58181289 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-[5-[(E)-2-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]ethenyl]thiophen-2-yl]ethyl acetate |
| SMILES | CC(=O)OCCc1ccc(/C=C/c2ccc(N3CCN(C(C)=O)CC3)cn2)s1 |
| InChI | InChI=1S/C21H25N3O3S/c1-16(25)23-10-12-24(13-11-23)19-5-3-18(22-15-19)4-6-20-7-8-21(28-20)9-14-27-17(2)26/h3-8,15H,9-14H2,1-2H3/b6-4+ |
| InChIKey | QZEYXDCISMQWJZ-GQCTYLIASA-N |
| XLogP | 3.09 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |