C20H27N3O2S — CID 58181239
1-[4-[6-[2-[5-(3-hydroxypropyl)thiophen-3-yl]ethyl]-3-pyridinyl]piperazin-1-yl]ethanone (PubChem CID 58181239) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 1-[4-[6-[2-[5-(3-hydroxypropyl)thiophen-3-yl]ethyl]-3-pyridinyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[6-[2-[5-(3-hydroxypropyl)thiophen-3-yl]ethyl]-3-pyridinyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 58181239 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[4-[6-[2-[5-(3-hydroxypropyl)thiophen-3-yl]ethyl]-3-pyridinyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(CCc3csc(CCCO)c3)nc2)CC1 |
| InChI | InChI=1S/C20H27N3O2S/c1-16(25)22-8-10-23(11-9-22)19-7-6-18(21-14-19)5-4-17-13-20(26-15-17)3-2-12-24/h6-7,13-15,24H,2-5,8-12H2,1H3 |
| InChIKey | KTIMBVLJYNYETQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |