C21H32N4 — CID 143901704
ethane;[4-[2-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]ethyl]phenyl]methanamine (PubChem CID 143901704) has the molecular formula C21H32N4 and a molecular weight of 340.52 g/mol. Its IUPAC name is ethane;[4-[2-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]ethyl]phenyl]methanamine.
| Compound Name | ethane;[4-[2-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]ethyl]phenyl]methanamine |
|---|---|
| PubChem CID | 143901704 |
| Molecular Formula | C21H32N4 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | ethane;[4-[2-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]ethyl]phenyl]methanamine |
| SMILES | CC.CN1CCN(c2ccc(CCc3ccc(CN)cc3)nc2)CC1 |
| InChI | InChI=1S/C19H26N4.C2H6/c1-22-10-12-23(13-11-22)19-9-8-18(21-15-19)7-6-16-2-4-17(14-20)5-3-16;1-2/h2-5,8-9,15H,6-7,10-14,20H2,1H3;1-2H3 |
| InChIKey | QERNRNDGWCOSPY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |