C31H35NO5Si — CID 18354921
2-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indole-4-carboxylic acid (PubChem CID 18354921) has the molecular formula C31H35NO5Si and a molecular weight of 529.71 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indole-4-carboxylic acid.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indole-4-carboxylic acid |
|---|---|
| PubChem CID | 18354921 |
| Molecular Formula | C31H35NO5Si |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indole-4-carboxylic acid |
| SMILES | Cc1c(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)n(C(=O)OC(C)(C)C)c2cccc(C(=O)O)c12 |
| InChI | InChI=1S/C31H35NO5Si/c1-21-26-24(28(33)34)19-14-20-25(26)32(29(35)36-30(2,3)4)27(21)37-38(31(5,6)7,22-15-10-8-11-16-22)23-17-12-9-13-18-23/h8-20H,1-7H3,(H,33,34) |
| InChIKey | YABZIJMFUWMPBF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|