C19H18N4O6 — CID 576688
dimethyl 1,2-bis(phenylcarbamoyl)diaziridine-3,3-dicarboxylate (PubChem CID 576688) has the molecular formula C19H18N4O6 and a molecular weight of 398.38 g/mol. Its IUPAC name is dimethyl 1,2-bis(phenylcarbamoyl)diaziridine-3,3-dicarboxylate.
| Compound Name | dimethyl 1,2-bis(phenylcarbamoyl)diaziridine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 576688 |
| Molecular Formula | C19H18N4O6 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | dimethyl 1,2-bis(phenylcarbamoyl)diaziridine-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)N(C(=O)Nc2ccccc2)N1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H18N4O6/c1-28-15(24)19(16(25)29-2)22(17(26)20-13-9-5-3-6-10-13)23(19)18(27)21-14-11-7-4-8-12-14/h3-12H,1-2H3,(H,20,26)(H,21,27) |
| InChIKey | FIZPGOPSZGIJPJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|