C19H18ClN3O3 — CID 19852461
methyl 2-[(4-chlorophenyl)carbamoyl]-4-methyl-5-phenyl-3H-pyrazole-4-carboxylate (PubChem CID 19852461) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is methyl 2-[(4-chlorophenyl)carbamoyl]-4-methyl-5-phenyl-3H-pyrazole-4-carboxylate.
| Compound Name | methyl 2-[(4-chlorophenyl)carbamoyl]-4-methyl-5-phenyl-3H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 19852461 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | methyl 2-[(4-chlorophenyl)carbamoyl]-4-methyl-5-phenyl-3H-pyrazole-4-carboxylate |
| SMILES | COC(=O)C1(C)CN(C(=O)Nc2ccc(Cl)cc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C19H18ClN3O3/c1-19(17(24)26-2)12-23(22-16(19)13-6-4-3-5-7-13)18(25)21-15-10-8-14(20)9-11-15/h3-11H,12H2,1-2H3,(H,21,25) |
| InChIKey | XFDQOIHEIKXHSC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |