C24H19Cl2N3O2 — CID 19852791
4-benzoyl-N,5-bis(4-chlorophenyl)-4-methyl-3H-pyrazole-2-carboxamide (PubChem CID 19852791) has the molecular formula C24H19Cl2N3O2 and a molecular weight of 452.34 g/mol. Its IUPAC name is 4-benzoyl-N,5-bis(4-chlorophenyl)-4-methyl-3H-pyrazole-2-carboxamide.
| Compound Name | 4-benzoyl-N,5-bis(4-chlorophenyl)-4-methyl-3H-pyrazole-2-carboxamide |
|---|---|
| PubChem CID | 19852791 |
| Molecular Formula | C24H19Cl2N3O2 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 4-benzoyl-N,5-bis(4-chlorophenyl)-4-methyl-3H-pyrazole-2-carboxamide |
| SMILES | CC1(C(=O)c2ccccc2)CN(C(=O)Nc2ccc(Cl)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19Cl2N3O2/c1-24(22(30)17-5-3-2-4-6-17)15-29(23(31)27-20-13-11-19(26)12-14-20)28-21(24)16-7-9-18(25)10-8-16/h2-14H,15H2,1H3,(H,27,31) |
| InChIKey | TXZLXDLTSNBLOZ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |