C19H17Cl2N3O2 — CID 19852210
4-acetyl-N,5-bis(4-chlorophenyl)-4-methyl-3H-pyrazole-2-carboxamide (PubChem CID 19852210) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is 4-acetyl-N,5-bis(4-chlorophenyl)-4-methyl-3H-pyrazole-2-carboxamide.
| Compound Name | 4-acetyl-N,5-bis(4-chlorophenyl)-4-methyl-3H-pyrazole-2-carboxamide |
|---|---|
| PubChem CID | 19852210 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 4-acetyl-N,5-bis(4-chlorophenyl)-4-methyl-3H-pyrazole-2-carboxamide |
| SMILES | CC(=O)C1(C)CN(C(=O)Nc2ccc(Cl)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17Cl2N3O2/c1-12(25)19(2)11-24(18(26)22-16-9-7-15(21)8-10-16)23-17(19)13-3-5-14(20)6-4-13/h3-10H,11H2,1-2H3,(H,22,26) |
| InChIKey | XRRCOKANTVLRIQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |