C19H14Cl2F3N3O2 — CID 18980972
5-(4-chlorophenyl)-4-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoyl]-3H-pyrazole-4-carbonyl chloride (PubChem CID 18980972) has the molecular formula C19H14Cl2F3N3O2 and a molecular weight of 444.24 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoyl]-3H-pyrazole-4-carbonyl chloride.
| Compound Name | 5-(4-chlorophenyl)-4-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoyl]-3H-pyrazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 18980972 |
| Molecular Formula | C19H14Cl2F3N3O2 |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 5-(4-chlorophenyl)-4-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoyl]-3H-pyrazole-4-carbonyl chloride |
| SMILES | CC1(C(=O)Cl)CN(C(=O)Nc2ccc(C(F)(F)F)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2F3N3O2/c1-18(16(21)28)10-27(26-15(18)11-2-6-13(20)7-3-11)17(29)25-14-8-4-12(5-9-14)19(22,23)24/h2-9H,10H2,1H3,(H,25,29) |
| InChIKey | OGQVGWNZKGIBJB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|