C23H23ClF3N3O2S — CID 19852074
4-acetyl-5-(4-chlorophenyl)-4-(3-methylsulfanylpropyl)-N-[4-(trifluoromethyl)phenyl]-3H-pyrazole-2-carboxamide (PubChem CID 19852074) has the molecular formula C23H23ClF3N3O2S and a molecular weight of 497.97 g/mol. Its IUPAC name is 4-acetyl-5-(4-chlorophenyl)-4-(3-methylsulfanylpropyl)-N-[4-(trifluoromethyl)phenyl]-3H-pyrazole-2-carboxamide.
| Compound Name | 4-acetyl-5-(4-chlorophenyl)-4-(3-methylsulfanylpropyl)-N-[4-(trifluoromethyl)phenyl]-3H-pyrazole-2-carboxamide |
|---|---|
| PubChem CID | 19852074 |
| Molecular Formula | C23H23ClF3N3O2S |
| Molecular Weight | 497.97 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 4-acetyl-5-(4-chlorophenyl)-4-(3-methylsulfanylpropyl)-N-[4-(trifluoromethyl)phenyl]-3H-pyrazole-2-carboxamide |
| SMILES | CSCCCC1(C(C)=O)CN(C(=O)Nc2ccc(C(F)(F)F)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClF3N3O2S/c1-15(31)22(12-3-13-33-2)14-30(29-20(22)16-4-8-18(24)9-5-16)21(32)28-19-10-6-17(7-11-19)23(25,26)27/h4-11H,3,12-14H2,1-2H3,(H,28,32) |
| InChIKey | UUELITZTEILUPA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.97 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|