C25H27ClF3N3O3S2 — CID 139656235
methyl [N-[2-[5-(4-chlorophenyl)-4-methyl-4-(3-methylsulfanylpropyl)-3H-pyrazol-2-yl]acetyl]-4-(trifluoromethyl)anilino]sulfanylformate (PubChem CID 139656235) has the molecular formula C25H27ClF3N3O3S2 and a molecular weight of 574.09 g/mol. Its IUPAC name is methyl [N-[2-[5-(4-chlorophenyl)-4-methyl-4-(3-methylsulfanylpropyl)-3H-pyrazol-2-yl]acetyl]-4-(trifluoromethyl)anilino]sulfanylformate.
| Compound Name | methyl [N-[2-[5-(4-chlorophenyl)-4-methyl-4-(3-methylsulfanylpropyl)-3H-pyrazol-2-yl]acetyl]-4-(trifluoromethyl)anilino]sulfanylformate |
|---|---|
| PubChem CID | 139656235 |
| Molecular Formula | C25H27ClF3N3O3S2 |
| Molecular Weight | 574.09 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | methyl [N-[2-[5-(4-chlorophenyl)-4-methyl-4-(3-methylsulfanylpropyl)-3H-pyrazol-2-yl]acetyl]-4-(trifluoromethyl)anilino]sulfanylformate |
| SMILES | COC(=O)SN(C(=O)CN1CC(C)(CCCSC)C(c2ccc(Cl)cc2)=N1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H27ClF3N3O3S2/c1-24(13-4-14-36-3)16-31(30-22(24)17-5-9-19(26)10-6-17)15-21(33)32(37-23(34)35-2)20-11-7-18(8-12-20)25(27,28)29/h5-12H,4,13-16H2,1-3H3 |
| InChIKey | BBWVPIPRGOYCAS-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.09 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|