C28H27ClF3N3O2S — CID 139656184
2-[5-(4-chlorophenyl)-4-methyl-4-phenyl-3H-pyrazol-2-yl]-N-(2-methoxyethylsulfanyl)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 139656184) has the molecular formula C28H27ClF3N3O2S and a molecular weight of 562.06 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-4-methyl-4-phenyl-3H-pyrazol-2-yl]-N-(2-methoxyethylsulfanyl)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[5-(4-chlorophenyl)-4-methyl-4-phenyl-3H-pyrazol-2-yl]-N-(2-methoxyethylsulfanyl)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 139656184 |
| Molecular Formula | C28H27ClF3N3O2S |
| Molecular Weight | 562.06 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-4-methyl-4-phenyl-3H-pyrazol-2-yl]-N-(2-methoxyethylsulfanyl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCCSN(C(=O)CN1CC(C)(c2ccccc2)C(c2ccc(Cl)cc2)=N1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H27ClF3N3O2S/c1-27(21-6-4-3-5-7-21)19-34(33-26(27)20-8-12-23(29)13-9-20)18-25(36)35(38-17-16-37-2)24-14-10-22(11-15-24)28(30,31)32/h3-15H,16-19H2,1-2H3 |
| InChIKey | ODHHHKATCBTYHM-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.06 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|