C22H23Cl2N3O3S — CID 54363812
methyl 4-[[5-(4-chlorophenyl)-2-[(4-chlorophenyl)carbamoyl]-4-methyl-3H-pyrazol-4-yl]sulfanyl]butanoate (PubChem CID 54363812) has the molecular formula C22H23Cl2N3O3S and a molecular weight of 480.42 g/mol. Its IUPAC name is methyl 4-[[5-(4-chlorophenyl)-2-[(4-chlorophenyl)carbamoyl]-4-methyl-3H-pyrazol-4-yl]sulfanyl]butanoate.
| Compound Name | methyl 4-[[5-(4-chlorophenyl)-2-[(4-chlorophenyl)carbamoyl]-4-methyl-3H-pyrazol-4-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 54363812 |
| Molecular Formula | C22H23Cl2N3O3S |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | methyl 4-[[5-(4-chlorophenyl)-2-[(4-chlorophenyl)carbamoyl]-4-methyl-3H-pyrazol-4-yl]sulfanyl]butanoate |
| SMILES | COC(=O)CCCSC1(C)CN(C(=O)Nc2ccc(Cl)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23Cl2N3O3S/c1-22(31-13-3-4-19(28)30-2)14-27(21(29)25-18-11-9-17(24)10-12-18)26-20(22)15-5-7-16(23)8-6-15/h5-12H,3-4,13-14H2,1-2H3,(H,25,29) |
| InChIKey | UOIWJIHSRSURFI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|