C21H18N2O — CID 131874554
(2S,3R)-N,2,3-triphenylaziridine-1-carboxamide (PubChem CID 131874554) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is (2S,3R)-N,2,3-triphenylaziridine-1-carboxamide.
| Compound Name | (2S,3R)-N,2,3-triphenylaziridine-1-carboxamide |
|---|---|
| PubChem CID | 131874554 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (2S,3R)-N,2,3-triphenylaziridine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H18N2O/c24-21(22-18-14-8-3-9-15-18)23-19(16-10-4-1-5-11-16)20(23)17-12-6-2-7-13-17/h1-15,19-20H,(H,22,24)/t19-,20+,23? |
| InChIKey | PQGRFKNXONDCHL-DETIRCLXSA-N |
| XLogP | 5.02 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|