C16H16N2O2 — CID 154595659
N,3-diphenyl-1,2-oxazolidine-2-carboxamide (PubChem CID 154595659) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N,3-diphenyl-1,2-oxazolidine-2-carboxamide.
| Compound Name | N,3-diphenyl-1,2-oxazolidine-2-carboxamide |
|---|---|
| PubChem CID | 154595659 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N,3-diphenyl-1,2-oxazolidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1OCCC1c1ccccc1 |
| InChI | InChI=1S/C16H16N2O2/c19-16(17-14-9-5-2-6-10-14)18-15(11-12-20-18)13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H,17,19) |
| InChIKey | OLOWXTQREWPGOE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |