C15H19NO2 — CID 121446372
2,2-dimethyl-1-(3-phenyl-1,2-oxazolidin-2-yl)but-3-en-1-one (PubChem CID 121446372) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2,2-dimethyl-1-(3-phenyl-1,2-oxazolidin-2-yl)but-3-en-1-one.
| Compound Name | 2,2-dimethyl-1-(3-phenyl-1,2-oxazolidin-2-yl)but-3-en-1-one |
|---|---|
| PubChem CID | 121446372 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2,2-dimethyl-1-(3-phenyl-1,2-oxazolidin-2-yl)but-3-en-1-one |
| SMILES | C=CC(C)(C)C(=O)N1OCCC1c1ccccc1 |
| InChI | InChI=1S/C15H19NO2/c1-4-15(2,3)14(17)16-13(10-11-18-16)12-8-6-5-7-9-12/h4-9,13H,1,10-11H2,2-3H3 |
| InChIKey | IGUNBDVVBCPMPR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|