C16H15FN2O — CID 47034423
N-(4-fluorophenyl)-2-phenylazetidine-1-carboxamide (PubChem CID 47034423) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-phenylazetidine-1-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2-phenylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 47034423 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-(4-fluorophenyl)-2-phenylazetidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)N1CCC1c1ccccc1 |
| InChI | InChI=1S/C16H15FN2O/c17-13-6-8-14(9-7-13)18-16(20)19-11-10-15(19)12-4-2-1-3-5-12/h1-9,15H,10-11H2,(H,18,20) |
| InChIKey | GOPNRLPIQHBHMO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |