C30H33N7O3 — CID 97299719
(1S,5S,9S)-2-N,6-N,10-N-triphenyl-2,6,10,13-tetrazatricyclo[7.3.1.05,13]tridecane-2,6,10-tricarboxamide (PubChem CID 97299719) has the molecular formula C30H33N7O3 and a molecular weight of 539.64 g/mol. Its IUPAC name is (1S,5S,9S)-2-N,6-N,10-N-triphenyl-2,6,10,13-tetrazatricyclo[7.3.1.05,13]tridecane-2,6,10-tricarboxamide.
| Compound Name | (1S,5S,9S)-2-N,6-N,10-N-triphenyl-2,6,10,13-tetrazatricyclo[7.3.1.05,13]tridecane-2,6,10-tricarboxamide |
|---|---|
| PubChem CID | 97299719 |
| Molecular Formula | C30H33N7O3 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | (1S,5S,9S)-2-N,6-N,10-N-triphenyl-2,6,10,13-tetrazatricyclo[7.3.1.05,13]tridecane-2,6,10-tricarboxamide |
| SMILES | O=C(Nc1ccccc1)N1CC[C@@H]2N(C(=O)Nc3ccccc3)CC[C@@H]3N(C(=O)Nc4ccccc4)CC[C@H]1N23 |
| InChI | InChI=1S/C30H33N7O3/c38-28(31-22-10-4-1-5-11-22)34-19-16-26-36(30(40)33-24-14-8-3-9-15-24)21-18-27-35(20-17-25(34)37(26)27)29(39)32-23-12-6-2-7-13-23/h1-15,25-27H,16-21H2,(H,31,38)(H,32,39)(H,33,40)/t25-,26-,27-/m1/s1 |
| InChIKey | KZABVRNPOUFTLG-ZONZVBGPSA-N |
| XLogP | 5.08 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |