C12H16N2OS — CID 134120823
2,4-dimethyl-N-phenyl-1,3-thiazolidine-3-carboxamide (PubChem CID 134120823) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 2,4-dimethyl-N-phenyl-1,3-thiazolidine-3-carboxamide.
| Compound Name | 2,4-dimethyl-N-phenyl-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 134120823 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2,4-dimethyl-N-phenyl-1,3-thiazolidine-3-carboxamide |
| SMILES | CC1CSC(C)N1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H16N2OS/c1-9-8-16-10(2)14(9)12(15)13-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H,13,15) |
| InChIKey | DVHBGIZCFUUURS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |