C42H36O4 — CID 10507865
dimethyl 2-[[(1S,3R)-1-benzyl-3-(2,2-diphenylethenyl)-2,2-diphenylcyclopropyl]methylidene]propanedioate (PubChem CID 10507865) has the molecular formula C42H36O4 and a molecular weight of 604.75 g/mol. Its IUPAC name is dimethyl 2-[[(1S,3R)-1-benzyl-3-(2,2-diphenylethenyl)-2,2-diphenylcyclopropyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[(1S,3R)-1-benzyl-3-(2,2-diphenylethenyl)-2,2-diphenylcyclopropyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 10507865 |
| Molecular Formula | C42H36O4 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | dimethyl 2-[[(1S,3R)-1-benzyl-3-(2,2-diphenylethenyl)-2,2-diphenylcyclopropyl]methylidene]propanedioate |
| SMILES | COC(=O)C(=C[C@@]1(Cc2ccccc2)[C@@H](C=C(c2ccccc2)c2ccccc2)C1(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C42H36O4/c1-45-39(43)37(40(44)46-2)30-41(29-31-18-8-3-9-19-31)38(28-36(32-20-10-4-11-21-32)33-22-12-5-13-23-33)42(41,34-24-14-6-15-25-34)35-26-16-7-17-27-35/h3-28,30,38H,29H2,1-2H3/t38-,41+/m1/s1 |
| InChIKey | MBJOCOXKCLQRDQ-UMBAWLCISA-N |
| XLogP | 8.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|