C22H24N4 — CID 141078485
1,2,3,4,5,6-hexamethyl-5-phenylcyclohexane-1,2,3,4-tetracarbonitrile (PubChem CID 141078485) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexamethyl-5-phenylcyclohexane-1,2,3,4-tetracarbonitrile.
| Compound Name | 1,2,3,4,5,6-hexamethyl-5-phenylcyclohexane-1,2,3,4-tetracarbonitrile |
|---|---|
| PubChem CID | 141078485 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1,2,3,4,5,6-hexamethyl-5-phenylcyclohexane-1,2,3,4-tetracarbonitrile |
| SMILES | CC1C(C)(C#N)C(C)(C#N)C(C)(C#N)C(C)(C#N)C1(C)c1ccccc1 |
| InChI | InChI=1S/C22H24N4/c1-16-18(2,12-23)19(3,13-24)20(4,14-25)21(5,15-26)22(16,6)17-10-8-7-9-11-17/h7-11,16H,1-6H3 |
| InChIKey | ULBVYFIWZGHFCV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |