C20H11N5 — CID 606327
3-phenyltricyclo[3.2.2.02,4]non-8-ene-3,6,6,7,7-pentacarbonitrile (PubChem CID 606327) has the molecular formula C20H11N5 and a molecular weight of 321.34 g/mol. Its IUPAC name is 3-phenyltricyclo[3.2.2.02,4]non-8-ene-3,6,6,7,7-pentacarbonitrile.
| Compound Name | 3-phenyltricyclo[3.2.2.02,4]non-8-ene-3,6,6,7,7-pentacarbonitrile |
|---|---|
| PubChem CID | 606327 |
| Molecular Formula | C20H11N5 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-phenyltricyclo[3.2.2.02,4]non-8-ene-3,6,6,7,7-pentacarbonitrile |
| SMILES | N#CC1(c2ccccc2)C2C1C1C=CC2C(C#N)(C#N)C1(C#N)C#N |
| InChI | InChI=1S/C20H11N5/c21-8-18(9-22)14-6-7-15(19(18,10-23)11-24)17-16(14)20(17,12-25)13-4-2-1-3-5-13/h1-7,14-17H |
| InChIKey | RAKXXRZXGUEUHB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 118.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|