C22H18N2 — CID 99952248
(2R,5S,7S,10R)-1,6-diphenyl-11,12-diazatetracyclo[4.4.2.02,5.07,10]dodeca-3,8,11-triene (PubChem CID 99952248) has the molecular formula C22H18N2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2R,5S,7S,10R)-1,6-diphenyl-11,12-diazatetracyclo[4.4.2.02,5.07,10]dodeca-3,8,11-triene.
| Compound Name | (2R,5S,7S,10R)-1,6-diphenyl-11,12-diazatetracyclo[4.4.2.02,5.07,10]dodeca-3,8,11-triene |
|---|---|
| PubChem CID | 99952248 |
| Molecular Formula | C22H18N2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2R,5S,7S,10R)-1,6-diphenyl-11,12-diazatetracyclo[4.4.2.02,5.07,10]dodeca-3,8,11-triene |
| SMILES | C1=C[C@H]2[C@@H]1C1(c3ccccc3)N=NC2(c2ccccc2)[C@H]2C=C[C@H]21 |
| InChI | InChI=1S/C22H18N2/c1-3-7-15(8-4-1)21-17-11-13-19(17)22(24-23-21,20-14-12-18(20)21)16-9-5-2-6-10-16/h1-14,17-20H/t17-,18-,19+,20+,21?,22? |
| InChIKey | XHUBGMGRWVFIGJ-ZQFQKNMJSA-N |
| XLogP | 4.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|