C17H20N2 — CID 124835458
(1S,2R,5R,6R,9R)-9-ethyl-1,9-dimethyl-6-phenyl-7,8-diazatricyclo[4.2.1.02,5]nona-3,7-diene (PubChem CID 124835458) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (1S,2R,5R,6R,9R)-9-ethyl-1,9-dimethyl-6-phenyl-7,8-diazatricyclo[4.2.1.02,5]nona-3,7-diene.
| Compound Name | (1S,2R,5R,6R,9R)-9-ethyl-1,9-dimethyl-6-phenyl-7,8-diazatricyclo[4.2.1.02,5]nona-3,7-diene |
|---|---|
| PubChem CID | 124835458 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (1S,2R,5R,6R,9R)-9-ethyl-1,9-dimethyl-6-phenyl-7,8-diazatricyclo[4.2.1.02,5]nona-3,7-diene |
| SMILES | CC[C@]1(C)[C@@]2(C)N=N[C@@]1(c1ccccc1)[C@@H]1C=C[C@H]12 |
| InChI | InChI=1S/C17H20N2/c1-4-15(2)16(3)13-10-11-14(13)17(15,19-18-16)12-8-6-5-7-9-12/h5-11,13-14H,4H2,1-3H3/t13-,14-,15-,16+,17+/m1/s1 |
| InChIKey | UKTLNKJCFDGWLI-MTSZKFMLSA-N |
| XLogP | 4.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|