C19H20N2 — CID 165343203
(1R,5R,6R)-4,4,6-trimethyl-1,5-diphenyl-2,3-diazabicyclo[3.1.0]hex-2-ene (PubChem CID 165343203) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (1R,5R,6R)-4,4,6-trimethyl-1,5-diphenyl-2,3-diazabicyclo[3.1.0]hex-2-ene.
| Compound Name | (1R,5R,6R)-4,4,6-trimethyl-1,5-diphenyl-2,3-diazabicyclo[3.1.0]hex-2-ene |
|---|---|
| PubChem CID | 165343203 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (1R,5R,6R)-4,4,6-trimethyl-1,5-diphenyl-2,3-diazabicyclo[3.1.0]hex-2-ene |
| SMILES | C[C@@H]1[C@@]2(c3ccccc3)C(C)(C)N=N[C@@]12c1ccccc1 |
| InChI | InChI=1S/C19H20N2/c1-14-18(15-10-6-4-7-11-15)17(2,3)20-21-19(14,18)16-12-8-5-9-13-16/h4-14H,1-3H3/t14-,18-,19-/m1/s1 |
| InChIKey | NFUQBWCYIAYGAA-NIKGAXFTSA-N |
| XLogP | 4.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |