C18H24 — CID 98557042
(1S,2R,3S,4S,5S)-2,3-dimethyl-4-phenyl-3-propyltricyclo[3.2.0.02,4]heptane (PubChem CID 98557042) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is (1S,2R,3S,4S,5S)-2,3-dimethyl-4-phenyl-3-propyltricyclo[3.2.0.02,4]heptane.
| Compound Name | (1S,2R,3S,4S,5S)-2,3-dimethyl-4-phenyl-3-propyltricyclo[3.2.0.02,4]heptane |
|---|---|
| PubChem CID | 98557042 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (1S,2R,3S,4S,5S)-2,3-dimethyl-4-phenyl-3-propyltricyclo[3.2.0.02,4]heptane |
| SMILES | CCC[C@@]1(C)[C@@]2(C)[C@H]3CC[C@@H]3[C@]12c1ccccc1 |
| InChI | InChI=1S/C18H24/c1-4-12-16(2)17(3)14-10-11-15(14)18(16,17)13-8-6-5-7-9-13/h5-9,14-15H,4,10-12H2,1-3H3/t14-,15-,16-,17+,18+/m0/s1 |
| InChIKey | SPBNJWFOBROSRP-NNPSNHGLSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |