C22H24N2 — CID 94037145
(1R,2R,5S,6R,9R)-9-benzyl-1,9-dimethyl-6-phenyl-7,8-diazatricyclo[4.2.1.02,5]non-7-ene (PubChem CID 94037145) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (1R,2R,5S,6R,9R)-9-benzyl-1,9-dimethyl-6-phenyl-7,8-diazatricyclo[4.2.1.02,5]non-7-ene.
| Compound Name | (1R,2R,5S,6R,9R)-9-benzyl-1,9-dimethyl-6-phenyl-7,8-diazatricyclo[4.2.1.02,5]non-7-ene |
|---|---|
| PubChem CID | 94037145 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (1R,2R,5S,6R,9R)-9-benzyl-1,9-dimethyl-6-phenyl-7,8-diazatricyclo[4.2.1.02,5]non-7-ene |
| SMILES | C[C@@]1(Cc2ccccc2)[C@]2(C)N=N[C@@]1(c1ccccc1)[C@H]1CC[C@H]12 |
| InChI | InChI=1S/C22H24N2/c1-20(15-16-9-5-3-6-10-16)21(2)18-13-14-19(18)22(20,24-23-21)17-11-7-4-8-12-17/h3-12,18-19H,13-15H2,1-2H3/t18-,19+,20-,21-,22+/m1/s1 |
| InChIKey | PADNZVDIAXXCGO-YHINDDMVSA-N |
| XLogP | 5.40 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |