C20H22N2S — CID 10663642
(1R,2S,6R,7R)-10,10-dimethyl-1-phenyl-7-thiophen-2-yl-8,9-diazatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 10663642) has the molecular formula C20H22N2S and a molecular weight of 322.48 g/mol. Its IUPAC name is (1R,2S,6R,7R)-10,10-dimethyl-1-phenyl-7-thiophen-2-yl-8,9-diazatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (1R,2S,6R,7R)-10,10-dimethyl-1-phenyl-7-thiophen-2-yl-8,9-diazatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 10663642 |
| Molecular Formula | C20H22N2S |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (1R,2S,6R,7R)-10,10-dimethyl-1-phenyl-7-thiophen-2-yl-8,9-diazatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | CC1(C)[C@]2(c3cccs3)N=N[C@@]1(c1ccccc1)[C@H]1CCC[C@H]12 |
| InChI | InChI=1S/C20H22N2S/c1-18(2)19(14-8-4-3-5-9-14)15-10-6-11-16(15)20(18,22-21-19)17-12-7-13-23-17/h3-5,7-9,12-13,15-16H,6,10-11H2,1-2H3/t15-,16+,19-,20-/m0/s1 |
| InChIKey | WUPBESZDFSAPNF-JSJNYSNDSA-N |
| XLogP | 5.76 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |