C18H21BrN2 — CID 10688862
(1R,2S,6R,7S)-1-[(Z)-2-bromoethenyl]-10,10-dimethyl-7-phenyl-8,9-diazatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 10688862) has the molecular formula C18H21BrN2 and a molecular weight of 345.28 g/mol. Its IUPAC name is (1R,2S,6R,7S)-1-[(Z)-2-bromoethenyl]-10,10-dimethyl-7-phenyl-8,9-diazatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (1R,2S,6R,7S)-1-[(Z)-2-bromoethenyl]-10,10-dimethyl-7-phenyl-8,9-diazatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 10688862 |
| Molecular Formula | C18H21BrN2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (1R,2S,6R,7S)-1-[(Z)-2-bromoethenyl]-10,10-dimethyl-7-phenyl-8,9-diazatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | CC1(C)[C@@]2(/C=C\Br)N=N[C@]1(c1ccccc1)[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C18H21BrN2/c1-16(2)17(11-12-19)14-9-6-10-15(14)18(16,21-20-17)13-7-4-3-5-8-13/h3-5,7-8,11-12,14-15H,6,9-10H2,1-2H3/b12-11-/t14-,15+,17-,18+/m0/s1 |
| InChIKey | PXQNJRNCVLBHAH-ROGYMLHDSA-N |
| XLogP | 5.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |