C22H24 — CID 102012333
(3aR,4S,6aS)-4,5-dimethyl-4,6-diphenyl-2,3,3a,6a-tetrahydro-1H-pentalene (PubChem CID 102012333) has the molecular formula C22H24 and a molecular weight of 288.43 g/mol. Its IUPAC name is (3aR,4S,6aS)-4,5-dimethyl-4,6-diphenyl-2,3,3a,6a-tetrahydro-1H-pentalene.
| Compound Name | (3aR,4S,6aS)-4,5-dimethyl-4,6-diphenyl-2,3,3a,6a-tetrahydro-1H-pentalene |
|---|---|
| PubChem CID | 102012333 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (3aR,4S,6aS)-4,5-dimethyl-4,6-diphenyl-2,3,3a,6a-tetrahydro-1H-pentalene |
| SMILES | CC1=C(c2ccccc2)[C@H]2CCC[C@H]2[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C22H24/c1-16-21(17-10-5-3-6-11-17)19-14-9-15-20(19)22(16,2)18-12-7-4-8-13-18/h3-8,10-13,19-20H,9,14-15H2,1-2H3/t19-,20+,22+/m0/s1 |
| InChIKey | DWBPDVRMGHOAIV-TUNNFDKTSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |