C23H24O2 — CID 102386619
(5aS,8aR,8bS)-2-methyl-5,8b-diphenyl-3,5a,6,7,8,8a-hexahydro-2H-pentaleno[1,2-b][1,4]dioxine (PubChem CID 102386619) has the molecular formula C23H24O2 and a molecular weight of 332.44 g/mol. Its IUPAC name is (5aS,8aR,8bS)-2-methyl-5,8b-diphenyl-3,5a,6,7,8,8a-hexahydro-2H-pentaleno[1,2-b][1,4]dioxine.
| Compound Name | (5aS,8aR,8bS)-2-methyl-5,8b-diphenyl-3,5a,6,7,8,8a-hexahydro-2H-pentaleno[1,2-b][1,4]dioxine |
|---|---|
| PubChem CID | 102386619 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (5aS,8aR,8bS)-2-methyl-5,8b-diphenyl-3,5a,6,7,8,8a-hexahydro-2H-pentaleno[1,2-b][1,4]dioxine |
| SMILES | CC1COC2=C(c3ccccc3)[C@H]3CCC[C@H]3[C@@]2(c2ccccc2)O1 |
| InChI | InChI=1S/C23H24O2/c1-16-15-24-22-21(17-9-4-2-5-10-17)19-13-8-14-20(19)23(22,25-16)18-11-6-3-7-12-18/h2-7,9-12,16,19-20H,8,13-15H2,1H3/t16?,19-,20+,23+/m0/s1 |
| InChIKey | FELRPDTZLZRDOP-GDBPIYEPSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |