C19H24 — CID 11779999
(3aR,4S,8bS)-4-methyl-4-phenyl-2,3,3a,5,6,7,8,8b-octahydro-1H-cyclopenta[a]indene (PubChem CID 11779999) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is (3aR,4S,8bS)-4-methyl-4-phenyl-2,3,3a,5,6,7,8,8b-octahydro-1H-cyclopenta[a]indene.
| Compound Name | (3aR,4S,8bS)-4-methyl-4-phenyl-2,3,3a,5,6,7,8,8b-octahydro-1H-cyclopenta[a]indene |
|---|---|
| PubChem CID | 11779999 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (3aR,4S,8bS)-4-methyl-4-phenyl-2,3,3a,5,6,7,8,8b-octahydro-1H-cyclopenta[a]indene |
| SMILES | C[C@]1(c2ccccc2)C2=C(CCCC2)[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C19H24/c1-19(14-8-3-2-4-9-14)17-12-6-5-10-15(17)16-11-7-13-18(16)19/h2-4,8-9,16,18H,5-7,10-13H2,1H3/t16-,18-,19+/m1/s1 |
| InChIKey | PXSHEVUJNUPSEK-QRQLOZEOSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|