C22H24 — CID 15267160
(2R,6R,7S,11R)-2-phenyltetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),12,14-triene (PubChem CID 15267160) has the molecular formula C22H24 and a molecular weight of 288.43 g/mol. Its IUPAC name is (2R,6R,7S,11R)-2-phenyltetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),12,14-triene.
| Compound Name | (2R,6R,7S,11R)-2-phenyltetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),12,14-triene |
|---|---|
| PubChem CID | 15267160 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (2R,6R,7S,11R)-2-phenyltetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),12,14-triene |
| SMILES | c1ccc([C@@]23CCC[C@@H]2[C@H]2CCC[C@H]2c2ccccc23)cc1 |
| InChI | InChI=1S/C22H24/c1-2-8-16(9-3-1)22-15-7-14-21(22)19-12-6-11-17(19)18-10-4-5-13-20(18)22/h1-5,8-10,13,17,19,21H,6-7,11-12,14-15H2/t17-,19-,21+,22+/m0/s1 |
| InChIKey | RZXZWXXJPYSNGO-HVJHZFLKSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |