C19H24N2 — CID 11780936
(1S,2S,6R,7S,8S)-8-methyl-7-phenyl-13,14-diazatetracyclo[5.5.2.01,8.02,6]tetradec-13-ene (PubChem CID 11780936) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is (1S,2S,6R,7S,8S)-8-methyl-7-phenyl-13,14-diazatetracyclo[5.5.2.01,8.02,6]tetradec-13-ene.
| Compound Name | (1S,2S,6R,7S,8S)-8-methyl-7-phenyl-13,14-diazatetracyclo[5.5.2.01,8.02,6]tetradec-13-ene |
|---|---|
| PubChem CID | 11780936 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (1S,2S,6R,7S,8S)-8-methyl-7-phenyl-13,14-diazatetracyclo[5.5.2.01,8.02,6]tetradec-13-ene |
| SMILES | C[C@]12CCCC[C@@]13N=N[C@]2(c1ccccc1)[C@@H]1CCC[C@@H]13 |
| InChI | InChI=1S/C19H24N2/c1-17-12-5-6-13-18(17)15-10-7-11-16(15)19(17,21-20-18)14-8-3-2-4-9-14/h2-4,8-9,15-16H,5-7,10-13H2,1H3/t15-,16+,17-,18-,19+/m0/s1 |
| InChIKey | HPFZXVCCGPUNFC-XCDZQEORSA-N |
| XLogP | 5.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |