C18H21IN2 — CID 177392545
(1S,2R,6S,7R)-1-[(Z)-2-iodoethenyl]-10,10-dimethyl-7-phenyl-8,9-diazatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 177392545) has the molecular formula C18H21IN2 and a molecular weight of 392.28 g/mol. Its IUPAC name is (1S,2R,6S,7R)-1-[(Z)-2-iodoethenyl]-10,10-dimethyl-7-phenyl-8,9-diazatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (1S,2R,6S,7R)-1-[(Z)-2-iodoethenyl]-10,10-dimethyl-7-phenyl-8,9-diazatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 177392545 |
| Molecular Formula | C18H21IN2 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (1S,2R,6S,7R)-1-[(Z)-2-iodoethenyl]-10,10-dimethyl-7-phenyl-8,9-diazatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | CC1(C)[C@]2(/C=C\I)N=N[C@@]1(c1ccccc1)[C@H]1CCC[C@H]12 |
| InChI | InChI=1S/C18H21IN2/c1-16(2)17(11-12-19)14-9-6-10-15(14)18(16,21-20-17)13-7-4-3-5-8-13/h3-5,7-8,11-12,14-15H,6,9-10H2,1-2H3/b12-11-/t14-,15+,17-,18+/m1/s1 |
| InChIKey | MXOPZXOXFNDIID-SFLKEMTLSA-N |
| XLogP | 5.49 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|