C13H16N2O2S — CID 92582827
(5R)-3-cyclopentyl-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione (PubChem CID 92582827) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is (5R)-3-cyclopentyl-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-cyclopentyl-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 92582827 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (5R)-3-cyclopentyl-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2cccs2)NC(=O)N(C2CCCC2)C1=O |
| InChI | InChI=1S/C13H16N2O2S/c1-13(10-7-4-8-18-10)11(16)15(12(17)14-13)9-5-2-3-6-9/h4,7-9H,2-3,5-6H2,1H3,(H,14,17)/t13-/m0/s1 |
| InChIKey | HIEFOQQNBOHLOY-ZDUSSCGKSA-N |
| XLogP | 2.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|