C16H15FN2O3S — CID 94385905
(5R)-3-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione (PubChem CID 94385905) has the molecular formula C16H15FN2O3S and a molecular weight of 334.37 g/mol. Its IUPAC name is (5R)-3-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94385905 |
| Molecular Formula | C16H15FN2O3S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (5R)-3-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2cccs2)NC(=O)N(C[C@@H](O)c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C16H15FN2O3S/c1-16(13-6-3-7-23-13)14(21)19(15(22)18-16)9-12(20)10-4-2-5-11(17)8-10/h2-8,12,20H,9H2,1H3,(H,18,22)/t12-,16+/m1/s1 |
| InChIKey | SJFBGFYRFIGDRD-WBMJQRKESA-N |
| XLogP | 2.39 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|